C21H19NO6S — CID 7229445
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 7229445) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 7229445 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccc(C(=O)OCC(=O)c3ccc[nH]3)cc2)c1 |
| InChI | InChI=1S/C21H19NO6S/c1-14-5-6-15(2)20(12-14)29(25,26)28-17-9-7-16(8-10-17)21(24)27-13-19(23)18-4-3-11-22-18/h3-12,22H,13H2,1-2H3 |
| InChIKey | IQBHZHUVZZRDBM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|