C21H21NO6S — CID 7229444
(3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(2,5-dimethylphenyl)sulfonyloxybenzoate (PubChem CID 7229444) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(2,5-dimethylphenyl)sulfonyloxybenzoate.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(2,5-dimethylphenyl)sulfonyloxybenzoate |
|---|---|
| PubChem CID | 7229444 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)methyl 4-(2,5-dimethylphenyl)sulfonyloxybenzoate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Oc2ccc(C(=O)OCc3c(C)noc3C)cc2)c1 |
| InChI | InChI=1S/C21H21NO6S/c1-13-5-6-14(2)20(11-13)29(24,25)28-18-9-7-17(8-10-18)21(23)26-12-19-15(3)22-27-16(19)4/h5-11H,12H2,1-4H3 |
| InChIKey | DGPOXFNVQCQAAO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 95.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|