About [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate (PubChem CID 4674121) has the molecular formula C14H11NO4
and a molecular weight of 257.25 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate |
| PubChem CID | 4674121 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCC(=O)c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C14H11NO4/c16-8-10-3-5-11(6-4-10)14(18)19-9-13(17)12-2-1-7-15-12/h1-8,15H,9H2 |
| InChIKey | GOASGCWMFGDKKV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate?
The IUPAC name of [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate (CID 4674121) is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate.
What is the SMILES notation for [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate?
The canonical SMILES for [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate is O=Cc1ccc(C(=O)OCC(=O)c2ccc[nH]2)cc1.
What is the InChIKey of [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate?
The InChIKey is GOASGCWMFGDKKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO4/c16-8-10-3-5-11(6-4-10)14(18)19-9-13(17)12-2-1-7-15-12/h1-8,15H,9H2.
What are the key properties of [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate?
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate has a molecular weight of 257.25 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 4-formylbenzoate is sourced from PubChem (CID 4674121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).