C16H17NO5 — CID 7558612
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-ethoxy-4-methoxybenzoate (PubChem CID 7558612) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-ethoxy-4-methoxybenzoate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-ethoxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 7558612 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 3-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)c2ccc[nH]2)ccc1OC |
| InChI | InChI=1S/C16H17NO5/c1-3-21-15-9-11(6-7-14(15)20-2)16(19)22-10-13(18)12-5-4-8-17-12/h4-9,17H,3,10H2,1-2H3 |
| InChIKey | NLJVJDFISAXSTG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |