C25H21ClO2 — CID 141154302
9-chloro-10-[2-(3,4-dimethoxyphenyl)prop-2-enyl]anthracene (PubChem CID 141154302) has the molecular formula C25H21ClO2 and a molecular weight of 388.89 g/mol. Its IUPAC name is 9-chloro-10-[2-(3,4-dimethoxyphenyl)prop-2-enyl]anthracene.
| Compound Name | 9-chloro-10-[2-(3,4-dimethoxyphenyl)prop-2-enyl]anthracene |
|---|---|
| PubChem CID | 141154302 |
| Molecular Formula | C25H21ClO2 |
| Molecular Weight | 388.89 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 9-chloro-10-[2-(3,4-dimethoxyphenyl)prop-2-enyl]anthracene |
| SMILES | C=C(Cc1c2ccccc2c(Cl)c2ccccc12)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H21ClO2/c1-16(17-12-13-23(27-2)24(15-17)28-3)14-22-18-8-4-6-10-20(18)25(26)21-11-7-5-9-19(21)22/h4-13,15H,1,14H2,2-3H3 |
| InChIKey | CAWRRWABUZWSCD-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.89 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|