C24H20Cl2O5 — CID 54079399
[2,4-dichloro-3-(3,4-dimethoxybenzoyl)phenyl] 2-(2-methylphenyl)acetate (PubChem CID 54079399) has the molecular formula C24H20Cl2O5 and a molecular weight of 459.33 g/mol. Its IUPAC name is [2,4-dichloro-3-(3,4-dimethoxybenzoyl)phenyl] 2-(2-methylphenyl)acetate.
| Compound Name | [2,4-dichloro-3-(3,4-dimethoxybenzoyl)phenyl] 2-(2-methylphenyl)acetate |
|---|---|
| PubChem CID | 54079399 |
| Molecular Formula | C24H20Cl2O5 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | [2,4-dichloro-3-(3,4-dimethoxybenzoyl)phenyl] 2-(2-methylphenyl)acetate |
| SMILES | COc1ccc(C(=O)c2c(Cl)ccc(OC(=O)Cc3ccccc3C)c2Cl)cc1OC |
| InChI | InChI=1S/C24H20Cl2O5/c1-14-6-4-5-7-15(14)13-21(27)31-19-11-9-17(25)22(23(19)26)24(28)16-8-10-18(29-2)20(12-16)30-3/h4-12H,13H2,1-3H3 |
| InChIKey | MLZPDXOZAVVYFQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|