C56H48O8 — CID 156694270
6,13-bis[bis(3,4-dimethoxyphenyl)methylidene]pentacene (PubChem CID 156694270) has the molecular formula C56H48O8 and a molecular weight of 848.99 g/mol. Its IUPAC name is 6,13-bis[bis(3,4-dimethoxyphenyl)methylidene]pentacene.
| Compound Name | 6,13-bis[bis(3,4-dimethoxyphenyl)methylidene]pentacene |
|---|---|
| PubChem CID | 156694270 |
| Molecular Formula | C56H48O8 |
| Molecular Weight | 848.99 g/mol |
| Exact Mass | 848.33 |
| IUPAC Name | 6,13-bis[bis(3,4-dimethoxyphenyl)methylidene]pentacene |
| SMILES | COc1ccc(C(c2ccc(OC)c(OC)c2)=c2c3cc4ccccc4cc3c(=C(c3ccc(OC)c(OC)c3)c3ccc(OC)c(OC)c3)c3cc4ccccc4cc23)cc1OC |
| InChI | InChI=1S/C56H48O8/c1-57-45-21-17-37(29-49(45)61-5)53(38-18-22-46(58-2)50(30-38)62-6)55-41-25-33-13-9-11-15-35(33)27-43(41)56(44-28-36-16-12-10-14-34(36)26-42(44)55)54(39-19-23-47(59-3)51(31-39)63-7)40-20-24-48(60-4)52(32-40)64-8/h9-32H,1-8H3 |
| InChIKey | GTOZAPXYIGITFQ-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.99 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|