C21H17NO2 — CID 54525996
3-(3,4-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-enenitrile (PubChem CID 54525996) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-enenitrile.
| Compound Name | 3-(3,4-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 54525996 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-enenitrile |
| SMILES | COc1ccc(C(=CC#N)c2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C21H17NO2/c1-23-20-11-10-16(14-21(20)24-2)18(12-13-22)19-9-5-7-15-6-3-4-8-17(15)19/h3-12,14H,1-2H3 |
| InChIKey | YTDQELRPKJRBRZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|