C24H21NO3 — CID 69348718
3-(2,3-dimethoxyphenyl)-3-(3-phenylmethoxyphenyl)prop-2-enenitrile (PubChem CID 69348718) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-3-(3-phenylmethoxyphenyl)prop-2-enenitrile.
| Compound Name | 3-(2,3-dimethoxyphenyl)-3-(3-phenylmethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 69348718 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-3-(3-phenylmethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cccc(C(=CC#N)c2cccc(OCc3ccccc3)c2)c1OC |
| InChI | InChI=1S/C24H21NO3/c1-26-23-13-7-12-22(24(23)27-2)21(14-15-25)19-10-6-11-20(16-19)28-17-18-8-4-3-5-9-18/h3-14,16H,17H2,1-2H3 |
| InChIKey | BPTBIDDKIQVOJK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|