C40H33NO5 — CID 67614321
(3,4-dimethoxyphenyl)-naphthalen-1-ylmethanone;(Z)-3-(3,4-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-enenitrile (PubChem CID 67614321) has the molecular formula C40H33NO5 and a molecular weight of 607.71 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-naphthalen-1-ylmethanone;(Z)-3-(3,4-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-enenitrile.
| Compound Name | (3,4-dimethoxyphenyl)-naphthalen-1-ylmethanone;(Z)-3-(3,4-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 67614321 |
| Molecular Formula | C40H33NO5 |
| Molecular Weight | 607.71 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | (3,4-dimethoxyphenyl)-naphthalen-1-ylmethanone;(Z)-3-(3,4-dimethoxyphenyl)-3-naphthalen-1-ylprop-2-enenitrile |
| SMILES | COc1ccc(/C(=C/C#N)c2cccc3ccccc23)cc1OC.COc1ccc(C(=O)c2cccc3ccccc23)cc1OC |
| InChI | InChI=1S/C21H17NO2.C19H16O3/c1-23-20-11-10-16(14-21(20)24-2)18(12-13-22)19-9-5-7-15-6-3-4-8-17(15)19;1-21-17-11-10-14(12-18(17)22-2)19(20)16-9-5-7-13-6-3-4-8-15(13)16/h3-12,14H,1-2H3;3-12H,1-2H3/b18-12-; |
| InChIKey | GGLXYAJIIYVFNZ-UWRQUICRSA-N |
| XLogP | 8.90 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.71 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|