C19H16O3 — CID 146006285
(2,5-dimethoxyphenyl)-naphthalen-1-ylmethanone (PubChem CID 146006285) has the molecular formula C19H16O3 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)-naphthalen-1-ylmethanone.
| Compound Name | (2,5-dimethoxyphenyl)-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 146006285 |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (2,5-dimethoxyphenyl)-naphthalen-1-ylmethanone |
| SMILES | COc1ccc(OC)c(C(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C19H16O3/c1-21-14-10-11-18(22-2)17(12-14)19(20)16-9-5-7-13-6-3-4-8-15(13)16/h3-12H,1-2H3 |
| InChIKey | NSKGHFACOFTHAV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |