C20H19NO4 — CID 122179760
(NZ)-N-[1-(2,5-dimethoxyphenyl)-2-naphthalen-1-yloxyethylidene]hydroxylamine (PubChem CID 122179760) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (NZ)-N-[1-(2,5-dimethoxyphenyl)-2-naphthalen-1-yloxyethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(2,5-dimethoxyphenyl)-2-naphthalen-1-yloxyethylidene]hydroxylamine |
|---|---|
| PubChem CID | 122179760 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (NZ)-N-[1-(2,5-dimethoxyphenyl)-2-naphthalen-1-yloxyethylidene]hydroxylamine |
| SMILES | COc1ccc(OC)c(/C(COc2cccc3ccccc23)=N/O)c1 |
| InChI | InChI=1S/C20H19NO4/c1-23-15-10-11-19(24-2)17(12-15)18(21-22)13-25-20-9-5-7-14-6-3-4-8-16(14)20/h3-12,22H,13H2,1-2H3/b21-18+ |
| InChIKey | NIICGBTZRPKQSG-DYTRJAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|