C46H36O6 — CID 139085652
(2,7-dimethoxynaphthalen-1-yl)-naphthalen-1-ylmethanone (PubChem CID 139085652) has the molecular formula C46H36O6 and a molecular weight of 684.79 g/mol. Its IUPAC name is (2,7-dimethoxynaphthalen-1-yl)-naphthalen-1-ylmethanone.
| Compound Name | (2,7-dimethoxynaphthalen-1-yl)-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 139085652 |
| Molecular Formula | C46H36O6 |
| Molecular Weight | 684.79 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | (2,7-dimethoxynaphthalen-1-yl)-naphthalen-1-ylmethanone |
| SMILES | COc1ccc2ccc(OC)c(C(=O)c3cccc4ccccc34)c2c1.COc1ccc2ccc(OC)c(C(=O)c3cccc4ccccc34)c2c1 |
| InChI | InChI=1S/2C23H18O3/c2*1-25-17-12-10-16-11-13-21(26-2)22(20(16)14-17)23(24)19-9-5-7-15-6-3-4-8-18(15)19/h2*3-14H,1-2H3 |
| InChIKey | WTELHRFZSKHFGS-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.79 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |