C32H24O6 — CID 141397623
3,6-dimethoxyphenanthrene-9-carboxylic acid;phenanthrene-1-carboxylic acid (PubChem CID 141397623) has the molecular formula C32H24O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is 3,6-dimethoxyphenanthrene-9-carboxylic acid;phenanthrene-1-carboxylic acid.
| Compound Name | 3,6-dimethoxyphenanthrene-9-carboxylic acid;phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 141397623 |
| Molecular Formula | C32H24O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 3,6-dimethoxyphenanthrene-9-carboxylic acid;phenanthrene-1-carboxylic acid |
| SMILES | COc1ccc2cc(C(=O)O)c3ccc(OC)cc3c2c1.O=C(O)c1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C17H14O4.C15H10O2/c1-20-11-4-3-10-7-16(17(18)19)13-6-5-12(21-2)9-15(13)14(10)8-11;16-15(17)14-7-3-6-12-11-5-2-1-4-10(11)8-9-13(12)14/h3-9H,1-2H3,(H,18,19);1-9H,(H,16,17) |
| InChIKey | ZPULKSDWWBMWJO-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|