C27H18O7 — CID 130368637
1-(2-carboxy-4-hydroxy-6-methoxynaphthalen-1-yl)oxyphenanthrene-3-carboxylic acid (PubChem CID 130368637) has the molecular formula C27H18O7 and a molecular weight of 454.43 g/mol. Its IUPAC name is 1-(2-carboxy-4-hydroxy-6-methoxynaphthalen-1-yl)oxyphenanthrene-3-carboxylic acid.
| Compound Name | 1-(2-carboxy-4-hydroxy-6-methoxynaphthalen-1-yl)oxyphenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 130368637 |
| Molecular Formula | C27H18O7 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 1-(2-carboxy-4-hydroxy-6-methoxynaphthalen-1-yl)oxyphenanthrene-3-carboxylic acid |
| SMILES | COc1ccc2c(Oc3cc(C(=O)O)cc4c3ccc3ccccc34)c(C(=O)O)cc(O)c2c1 |
| InChI | InChI=1S/C27H18O7/c1-33-16-7-9-19-21(12-16)23(28)13-22(27(31)32)25(19)34-24-11-15(26(29)30)10-20-17-5-3-2-4-14(17)6-8-18(20)24/h2-13,28H,1H3,(H,29,30)(H,31,32) |
| InChIKey | XLZAWCDSUDWXIO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|