C44H30O8 — CID 139085404
bis(1-benzoyl-7-methoxynaphthalen-2-yl) benzene-1,4-dicarboxylate (PubChem CID 139085404) has the molecular formula C44H30O8 and a molecular weight of 686.72 g/mol. Its IUPAC name is bis(1-benzoyl-7-methoxynaphthalen-2-yl) benzene-1,4-dicarboxylate.
| Compound Name | bis(1-benzoyl-7-methoxynaphthalen-2-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139085404 |
| Molecular Formula | C44H30O8 |
| Molecular Weight | 686.72 g/mol |
| Exact Mass | 686.19 |
| IUPAC Name | bis(1-benzoyl-7-methoxynaphthalen-2-yl) benzene-1,4-dicarboxylate |
| SMILES | COc1ccc2ccc(OC(=O)c3ccc(C(=O)Oc4ccc5ccc(OC)cc5c4C(=O)c4ccccc4)cc3)c(C(=O)c3ccccc3)c2c1 |
| InChI | InChI=1S/C44H30O8/c1-49-33-21-17-27-19-23-37(39(35(27)25-33)41(45)29-9-5-3-6-10-29)51-43(47)31-13-15-32(16-14-31)44(48)52-38-24-20-28-18-22-34(50-2)26-36(28)40(38)42(46)30-11-7-4-8-12-30/h3-26H,1-2H3 |
| InChIKey | LGWMSONYYYLCIH-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.72 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|