C40H32N2O8 — CID 23257079
[5-benzoyloxy-9,11-bis[(4-methoxyphenyl)methyl]-10,12-dioxo-9,11-diazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-4-yl] benzoate (PubChem CID 23257079) has the molecular formula C40H32N2O8 and a molecular weight of 668.70 g/mol. Its IUPAC name is [5-benzoyloxy-9,11-bis[(4-methoxyphenyl)methyl]-10,12-dioxo-9,11-diazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-4-yl] benzoate.
| Compound Name | [5-benzoyloxy-9,11-bis[(4-methoxyphenyl)methyl]-10,12-dioxo-9,11-diazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-4-yl] benzoate |
|---|---|
| PubChem CID | 23257079 |
| Molecular Formula | C40H32N2O8 |
| Molecular Weight | 668.70 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | [5-benzoyloxy-9,11-bis[(4-methoxyphenyl)methyl]-10,12-dioxo-9,11-diazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-4-yl] benzoate |
| SMILES | COc1ccc(CN2C(=O)C3c4cc(OC(=O)c5ccccc5)c(OC(=O)c5ccccc5)cc4C2C(=O)N3Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H32N2O8/c1-47-29-17-13-25(14-18-29)23-41-35-31-21-33(49-39(45)27-9-5-3-6-10-27)34(50-40(46)28-11-7-4-8-12-28)22-32(31)36(37(41)43)42(38(35)44)24-26-15-19-30(48-2)20-16-26/h3-22,35-36H,23-24H2,1-2H3 |
| InChIKey | COXMGGCXEUOSFK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|