C29H41NO4Si — CID 134936672
4-benzoyl-1-[(4-methoxyphenyl)methyl]-3-[1-tri(propan-2-yl)silyloxyethyl]azetidin-2-one (PubChem CID 134936672) has the molecular formula C29H41NO4Si and a molecular weight of 495.74 g/mol. Its IUPAC name is 4-benzoyl-1-[(4-methoxyphenyl)methyl]-3-[1-tri(propan-2-yl)silyloxyethyl]azetidin-2-one.
| Compound Name | 4-benzoyl-1-[(4-methoxyphenyl)methyl]-3-[1-tri(propan-2-yl)silyloxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 134936672 |
| Molecular Formula | C29H41NO4Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 4-benzoyl-1-[(4-methoxyphenyl)methyl]-3-[1-tri(propan-2-yl)silyloxyethyl]azetidin-2-one |
| SMILES | COc1ccc(CN2C(=O)C(C(C)O[Si](C(C)C)(C(C)C)C(C)C)C2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H41NO4Si/c1-19(2)35(20(3)4,21(5)6)34-22(7)26-27(28(31)24-12-10-9-11-13-24)30(29(26)32)18-23-14-16-25(33-8)17-15-23/h9-17,19-22,26-27H,18H2,1-8H3 |
| InChIKey | FQQGEXCQNAQPSO-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|