C27H27NO4 — CID 102080275
(3R,4S)-4-benzoyl-1-benzyl-3-[methoxy-(4-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 102080275) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (3R,4S)-4-benzoyl-1-benzyl-3-[methoxy-(4-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | (3R,4S)-4-benzoyl-1-benzyl-3-[methoxy-(4-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102080275 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (3R,4S)-4-benzoyl-1-benzyl-3-[methoxy-(4-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(C(OC)[C@@H]2C(=O)N(Cc3ccccc3)C[C@H]2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H27NO4/c1-31-22-15-13-21(14-16-22)26(32-2)24-23(25(29)20-11-7-4-8-12-20)18-28(27(24)30)17-19-9-5-3-6-10-19/h3-16,23-24,26H,17-18H2,1-2H3/t23-,24-,26?/m1/s1 |
| InChIKey | MNIRVGIAFRCHND-LBHOTPKDSA-N |
| XLogP | 4.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |