C19H19NO3 — CID 102222629
3-benzyl-5-[1-(4-methoxyphenyl)ethenyl]-1,3-oxazolidin-2-one (PubChem CID 102222629) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-benzyl-5-[1-(4-methoxyphenyl)ethenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-benzyl-5-[1-(4-methoxyphenyl)ethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102222629 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-benzyl-5-[1-(4-methoxyphenyl)ethenyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(c1ccc(OC)cc1)C1CN(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C19H19NO3/c1-14(16-8-10-17(22-2)11-9-16)18-13-20(19(21)23-18)12-15-6-4-3-5-7-15/h3-11,18H,1,12-13H2,2H3 |
| InChIKey | MVYWIWQGJHWCCG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |