C23H23NO2 — CID 102591007
3-benzyl-5-(5-methyl-3-phenylhexa-1,3,4-trien-2-yl)-1,3-oxazolidin-2-one (PubChem CID 102591007) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-benzyl-5-(5-methyl-3-phenylhexa-1,3,4-trien-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | 3-benzyl-5-(5-methyl-3-phenylhexa-1,3,4-trien-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102591007 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-benzyl-5-(5-methyl-3-phenylhexa-1,3,4-trien-2-yl)-1,3-oxazolidin-2-one |
| SMILES | C=C(C(=C=C(C)C)c1ccccc1)C1CN(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C23H23NO2/c1-17(2)14-21(20-12-8-5-9-13-20)18(3)22-16-24(23(25)26-22)15-19-10-6-4-7-11-19/h4-13,22H,3,15-16H2,1-2H3 |
| InChIKey | WTSROJODGBVEPR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|