C31H35NO2 — CID 71818948
(5R)-3-benzyl-5-[(1Z)-1-cyclohexyl-4-cyclopentylidene-3-phenylbuta-1,3-dien-2-yl]-1,3-oxazolidin-2-one (PubChem CID 71818948) has the molecular formula C31H35NO2 and a molecular weight of 453.63 g/mol. Its IUPAC name is (5R)-3-benzyl-5-[(1Z)-1-cyclohexyl-4-cyclopentylidene-3-phenylbuta-1,3-dien-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-benzyl-5-[(1Z)-1-cyclohexyl-4-cyclopentylidene-3-phenylbuta-1,3-dien-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71818948 |
| Molecular Formula | C31H35NO2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (5R)-3-benzyl-5-[(1Z)-1-cyclohexyl-4-cyclopentylidene-3-phenylbuta-1,3-dien-2-yl]-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@H](/C(=C\C2CCCCC2)C(=C=C2CCCC2)c2ccccc2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C31H35NO2/c33-31-32(22-26-16-6-2-7-17-26)23-30(34-31)29(21-25-12-4-1-5-13-25)28(20-24-14-10-11-15-24)27-18-8-3-9-19-27/h2-3,6-9,16-19,21,25,30H,1,4-5,10-15,22-23H2/b29-21-/t30-/m0/s1 |
| InChIKey | MPTNZMJZSFOPKJ-ZWBQBCQRSA-N |
| XLogP | 7.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|