C12H15NO2 — CID 58532625
3-benzyl-5-ethyl-1,3-oxazolidin-2-one (PubChem CID 58532625) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-benzyl-5-ethyl-1,3-oxazolidin-2-one.
| Compound Name | 3-benzyl-5-ethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58532625 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-benzyl-5-ethyl-1,3-oxazolidin-2-one |
| SMILES | CCC1CN(Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C12H15NO2/c1-2-11-9-13(12(14)15-11)8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3 |
| InChIKey | VBWOJKVGKVWGFP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |