C13H17NO3 — CID 117274608
3-benzyl-6-(2-hydroxyethyl)-1,3-oxazinan-2-one (PubChem CID 117274608) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-benzyl-6-(2-hydroxyethyl)-1,3-oxazinan-2-one.
| Compound Name | 3-benzyl-6-(2-hydroxyethyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117274608 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-benzyl-6-(2-hydroxyethyl)-1,3-oxazinan-2-one |
| SMILES | O=C1OC(CCO)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c15-9-7-12-6-8-14(13(16)17-12)10-11-4-2-1-3-5-11/h1-5,12,15H,6-10H2 |
| InChIKey | KODLHHFDMWECBG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |