C12H15NO4 — CID 70601041
(6S)-3-benzyl-6-(dihydroxymethyl)-1,3-oxazinan-2-one (PubChem CID 70601041) has the molecular formula C12H15NO4 and a molecular weight of 237.26 g/mol. Its IUPAC name is (6S)-3-benzyl-6-(dihydroxymethyl)-1,3-oxazinan-2-one.
| Compound Name | (6S)-3-benzyl-6-(dihydroxymethyl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 70601041 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (6S)-3-benzyl-6-(dihydroxymethyl)-1,3-oxazinan-2-one |
| SMILES | O=C1O[C@H](C(O)O)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C12H15NO4/c14-11(15)10-6-7-13(12(16)17-10)8-9-4-2-1-3-5-9/h1-5,10-11,14-15H,6-8H2/t10-/m0/s1 |
| InChIKey | PPHFKBUODRWSKG-JTQLQIEISA-N |
| XLogP | 0.71 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|