C12H15NO2 — CID 122420073
(5S)-3-benzyl-5-methyl-1,3-oxazinan-2-one (PubChem CID 122420073) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (5S)-3-benzyl-5-methyl-1,3-oxazinan-2-one.
| Compound Name | (5S)-3-benzyl-5-methyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 122420073 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (5S)-3-benzyl-5-methyl-1,3-oxazinan-2-one |
| SMILES | C[C@@H]1COC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C12H15NO2/c1-10-7-13(12(14)15-9-10)8-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3/t10-/m0/s1 |
| InChIKey | SDSUHKSSQWGMIC-JTQLQIEISA-N |
| XLogP | 2.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |