C17H17NO2 — CID 6562474
(4-methoxyphenyl)-[(2R,3R)-1-methyl-3-phenylaziridin-2-yl]methanone (PubChem CID 6562474) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (4-methoxyphenyl)-[(2R,3R)-1-methyl-3-phenylaziridin-2-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[(2R,3R)-1-methyl-3-phenylaziridin-2-yl]methanone |
|---|---|
| PubChem CID | 6562474 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (4-methoxyphenyl)-[(2R,3R)-1-methyl-3-phenylaziridin-2-yl]methanone |
| SMILES | COc1ccc(C(=O)[C@H]2[C@@H](c3ccccc3)N2C)cc1 |
| InChI | InChI=1S/C17H17NO2/c1-18-15(12-6-4-3-5-7-12)16(18)17(19)13-8-10-14(20-2)11-9-13/h3-11,15-16H,1-2H3/t15-,16-,18?/m1/s1 |
| InChIKey | BJQIWIMEODHOEW-JNIOUFIGSA-N |
| XLogP | 2.93 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|