C23H29NO2 — CID 101197737
[(2R,3S)-2-(4-methoxyphenyl)-1-pentylpyrrolidin-3-yl]-phenylmethanone (PubChem CID 101197737) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is [(2R,3S)-2-(4-methoxyphenyl)-1-pentylpyrrolidin-3-yl]-phenylmethanone.
| Compound Name | [(2R,3S)-2-(4-methoxyphenyl)-1-pentylpyrrolidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101197737 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | [(2R,3S)-2-(4-methoxyphenyl)-1-pentylpyrrolidin-3-yl]-phenylmethanone |
| SMILES | CCCCCN1CC[C@H](C(=O)c2ccccc2)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H29NO2/c1-3-4-8-16-24-17-15-21(23(25)19-9-6-5-7-10-19)22(24)18-11-13-20(26-2)14-12-18/h5-7,9-14,21-22H,3-4,8,15-17H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | OWDOCEPMWFYADN-VXKWHMMOSA-N |
| XLogP | 5.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|