About butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine
butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine (PubChem CID 156731865) has the molecular formula C23H41NO2
and a molecular weight of 363.59 g/mol. Its IUPAC name is butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine.
Molecular Properties
| Compound Name | butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine |
| PubChem CID | 156731865 |
| Molecular Formula | C23H41NO2 |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine |
| SMILES | CCC(C)=O.CCCCCN1CC[C@@H]1CC.CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C10H21N.C9H12O.C4H8O/c1-3-5-6-8-11-9-7-10(11)4-2;1-3-8-4-6-9(10-2)7-5-8;1-3-4(2)5/h10H,3-9H2,1-2H3;4-7H,3H2,1-2H3;3H2,1-2H3/t10-;;/m0../s1 |
| InChIKey | NVACIGDDCREWHX-XRIOVQLTSA-N |
| XLogP | 5.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine?
The IUPAC name of butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine (CID 156731865) is butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine.
What is the SMILES notation for butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine?
The canonical SMILES for butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine is CCC(C)=O.CCCCCN1CC[C@@H]1CC.CCc1ccc(OC)cc1.
What is the InChIKey of butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine?
The InChIKey is NVACIGDDCREWHX-XRIOVQLTSA-N. The full InChI is InChI=1S/C10H21N.C9H12O.C4H8O/c1-3-5-6-8-11-9-7-10(11)4-2;1-3-8-4-6-9(10-2)7-5-8;1-3-4(2)5/h10H,3-9H2,1-2H3;4-7H,3H2,1-2H3;3H2,1-2H3/t10-;;/m0../s1.
What are the key properties of butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine?
butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine has a molecular weight of 363.59 g/mol, XLogP of 5.90, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;1-ethyl-4-methoxybenzene;(2S)-2-ethyl-1-pentylazetidine is sourced from PubChem (CID 156731865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).