C25H34N2O3 — CID 167749267
1,3-bis[2-[(4-methoxyphenyl)methyl]azetidin-1-yl]propan-2-ol (PubChem CID 167749267) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 1,3-bis[2-[(4-methoxyphenyl)methyl]azetidin-1-yl]propan-2-ol.
| Compound Name | 1,3-bis[2-[(4-methoxyphenyl)methyl]azetidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 167749267 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 1,3-bis[2-[(4-methoxyphenyl)methyl]azetidin-1-yl]propan-2-ol |
| SMILES | COc1ccc(CC2CCN2CC(O)CN2CCC2Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H34N2O3/c1-29-24-7-3-19(4-8-24)15-21-11-13-26(21)17-23(28)18-27-14-12-22(27)16-20-5-9-25(30-2)10-6-20/h3-10,21-23,28H,11-18H2,1-2H3 |
| InChIKey | SSYBWXTWZQRMIQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |