C33H29NO5 — CID 23903316
1-benzoyl-4-(4-methoxybenzoyl)-5-(4-methylphenyl)-3-phenylpyrrolidine-2-carboxylic acid (PubChem CID 23903316) has the molecular formula C33H29NO5 and a molecular weight of 519.60 g/mol. Its IUPAC name is 1-benzoyl-4-(4-methoxybenzoyl)-5-(4-methylphenyl)-3-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-benzoyl-4-(4-methoxybenzoyl)-5-(4-methylphenyl)-3-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23903316 |
| Molecular Formula | C33H29NO5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 1-benzoyl-4-(4-methoxybenzoyl)-5-(4-methylphenyl)-3-phenylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C(=O)C2C(c3ccccc3)C(C(=O)O)N(C(=O)c3ccccc3)C2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C33H29NO5/c1-21-13-15-23(16-14-21)29-28(31(35)24-17-19-26(39-2)20-18-24)27(22-9-5-3-6-10-22)30(33(37)38)34(29)32(36)25-11-7-4-8-12-25/h3-20,27-30H,1-2H3,(H,37,38) |
| InChIKey | NZTDRWUZRSRSGW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |