C34H33N3O4 — CID 23933335
4-(4-methoxybenzoyl)-1-N,5-bis(4-methylphenyl)-3-phenylpyrrolidine-1,2-dicarboxamide (PubChem CID 23933335) has the molecular formula C34H33N3O4 and a molecular weight of 547.66 g/mol. Its IUPAC name is 4-(4-methoxybenzoyl)-1-N,5-bis(4-methylphenyl)-3-phenylpyrrolidine-1,2-dicarboxamide.
| Compound Name | 4-(4-methoxybenzoyl)-1-N,5-bis(4-methylphenyl)-3-phenylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 23933335 |
| Molecular Formula | C34H33N3O4 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 4-(4-methoxybenzoyl)-1-N,5-bis(4-methylphenyl)-3-phenylpyrrolidine-1,2-dicarboxamide |
| SMILES | COc1ccc(C(=O)C2C(c3ccccc3)C(C(N)=O)N(C(=O)Nc3ccc(C)cc3)C2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H33N3O4/c1-21-9-13-24(14-10-21)30-29(32(38)25-15-19-27(41-3)20-16-25)28(23-7-5-4-6-8-23)31(33(35)39)37(30)34(40)36-26-17-11-22(2)12-18-26/h4-20,28-31H,1-3H3,(H2,35,39)(H,36,40) |
| InChIKey | VWWYGJXZJYUNQB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |