C24H18N2O4 — CID 134927133
2-[(2S,3R)-2-(4-methoxybenzoyl)-3-phenylaziridin-1-yl]isoindole-1,3-dione (PubChem CID 134927133) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[(2S,3R)-2-(4-methoxybenzoyl)-3-phenylaziridin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R)-2-(4-methoxybenzoyl)-3-phenylaziridin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134927133 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[(2S,3R)-2-(4-methoxybenzoyl)-3-phenylaziridin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@@H](c3ccccc3)N2N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H18N2O4/c1-30-17-13-11-16(12-14-17)22(27)21-20(15-7-3-2-4-8-15)25(21)26-23(28)18-9-5-6-10-19(18)24(26)29/h2-14,20-21H,1H3/t20-,21+,25?/m1/s1 |
| InChIKey | YFBJJATYCNHLQT-GJAAFAAWSA-N |
| XLogP | 3.51 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|