C25H18N2O6 — CID 102597639
2-[(2R,3R)-2-(4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 102597639) has the molecular formula C25H18N2O6 and a molecular weight of 442.43 g/mol. Its IUPAC name is 2-[(2R,3R)-2-(4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[(2R,3R)-2-(4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 102597639 |
| Molecular Formula | C25H18N2O6 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[(2R,3R)-2-(4-methoxyphenyl)-4-oxo-1-phenylazetidin-3-yl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | COc1ccc([C@@H]2[C@@H](N3C(=O)c4ccc(C(=O)O)cc4C3=O)C(=O)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H18N2O6/c1-33-17-10-7-14(8-11-17)20-21(24(30)26(20)16-5-3-2-4-6-16)27-22(28)18-12-9-15(25(31)32)13-19(18)23(27)29/h2-13,20-21H,1H3,(H,31,32)/t20-,21-/m1/s1 |
| InChIKey | RTSIPJVWOCXCNO-NHCUHLMSSA-N |
| XLogP | 3.15 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|