C22H18N2O4 — CID 17409789
4-[3-(3-methoxyphenyl)-4-oxo-1,2-dihydroquinazolin-2-yl]benzoic acid (PubChem CID 17409789) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-[3-(3-methoxyphenyl)-4-oxo-1,2-dihydroquinazolin-2-yl]benzoic acid.
| Compound Name | 4-[3-(3-methoxyphenyl)-4-oxo-1,2-dihydroquinazolin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 17409789 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[3-(3-methoxyphenyl)-4-oxo-1,2-dihydroquinazolin-2-yl]benzoic acid |
| SMILES | COc1cccc(N2C(=O)c3ccccc3NC2c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C22H18N2O4/c1-28-17-6-4-5-16(13-17)24-20(14-9-11-15(12-10-14)22(26)27)23-19-8-3-2-7-18(19)21(24)25/h2-13,20,23H,1H3,(H,26,27) |
| InChIKey | ILPQIZFOSMVPOW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |