C20H17N3O2 — CID 75412903
3-(3-methoxyphenyl)-2-pyridin-2-yl-1,2-dihydroquinazolin-4-one (PubChem CID 75412903) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2-pyridin-2-yl-1,2-dihydroquinazolin-4-one.
| Compound Name | 3-(3-methoxyphenyl)-2-pyridin-2-yl-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 75412903 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 3-(3-methoxyphenyl)-2-pyridin-2-yl-1,2-dihydroquinazolin-4-one |
| SMILES | COc1cccc(N2C(=O)c3ccccc3NC2c2ccccn2)c1 |
| InChI | InChI=1S/C20H17N3O2/c1-25-15-8-6-7-14(13-15)23-19(18-11-4-5-12-21-18)22-17-10-3-2-9-16(17)20(23)24/h2-13,19,22H,1H3 |
| InChIKey | IHTWGOWZWSJIDG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |