C22H18N2O4 — CID 101241653
4-[5-(4-methoxyphenyl)-4-phenyl-5H-1,2,4-oxadiazol-3-yl]benzoic acid (PubChem CID 101241653) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-4-phenyl-5H-1,2,4-oxadiazol-3-yl]benzoic acid.
| Compound Name | 4-[5-(4-methoxyphenyl)-4-phenyl-5H-1,2,4-oxadiazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 101241653 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-4-phenyl-5H-1,2,4-oxadiazol-3-yl]benzoic acid |
| SMILES | COc1ccc(C2ON=C(c3ccc(C(=O)O)cc3)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18N2O4/c1-27-19-13-11-16(12-14-19)21-24(18-5-3-2-4-6-18)20(23-28-21)15-7-9-17(10-8-15)22(25)26/h2-14,21H,1H3,(H,25,26) |
| InChIKey | JRRUKJRHOAYRFE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |