C30H22N4O5 — CID 132572475
2-[(2S,3R)-2-(4-methoxyphenyl)-3-[N-(4-nitrophenyl)-C-phenylcarbonimidoyl]aziridin-1-yl]isoindole-1,3-dione (PubChem CID 132572475) has the molecular formula C30H22N4O5 and a molecular weight of 518.53 g/mol. Its IUPAC name is 2-[(2S,3R)-2-(4-methoxyphenyl)-3-[N-(4-nitrophenyl)-C-phenylcarbonimidoyl]aziridin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R)-2-(4-methoxyphenyl)-3-[N-(4-nitrophenyl)-C-phenylcarbonimidoyl]aziridin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132572475 |
| Molecular Formula | C30H22N4O5 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2-[(2S,3R)-2-(4-methoxyphenyl)-3-[N-(4-nitrophenyl)-C-phenylcarbonimidoyl]aziridin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc([C@H]2[C@H](/C(=N/c3ccc([N+](=O)[O-])cc3)c3ccccc3)N2N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C30H22N4O5/c1-39-23-17-11-20(12-18-23)27-28(32(27)33-29(35)24-9-5-6-10-25(24)30(33)36)26(19-7-3-2-4-8-19)31-21-13-15-22(16-14-21)34(37)38/h2-18,27-28H,1H3/b31-26+/t27-,28-,32?/m0/s1 |
| InChIKey | ADCRODBJBRMXJQ-HGJBILEVSA-N |
| XLogP | 5.36 |
| TPSA | 105.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|