C33H29N3O7 — CID 23789878
4-benzoyl-5-(4-methoxyphenyl)-2-methyl-3-(4-nitrophenyl)-1-(phenylcarbamoyl)pyrrolidine-2-carboxylic acid (PubChem CID 23789878) has the molecular formula C33H29N3O7 and a molecular weight of 579.61 g/mol. Its IUPAC name is 4-benzoyl-5-(4-methoxyphenyl)-2-methyl-3-(4-nitrophenyl)-1-(phenylcarbamoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 4-benzoyl-5-(4-methoxyphenyl)-2-methyl-3-(4-nitrophenyl)-1-(phenylcarbamoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23789878 |
| Molecular Formula | C33H29N3O7 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | 4-benzoyl-5-(4-methoxyphenyl)-2-methyl-3-(4-nitrophenyl)-1-(phenylcarbamoyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C2C(C(=O)c3ccccc3)C(c3ccc([N+](=O)[O-])cc3)C(C)(C(=O)O)N2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C33H29N3O7/c1-33(31(38)39)28(21-13-17-25(18-14-21)36(41)42)27(30(37)23-9-5-3-6-10-23)29(22-15-19-26(43-2)20-16-22)35(33)32(40)34-24-11-7-4-8-12-24/h3-20,27-29H,1-2H3,(H,34,40)(H,38,39) |
| InChIKey | IGXBRQBYQKQYEK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|