C28H26N2O7S — CID 23993867
1-(cyclopropanecarbonyl)-5-(4-methoxyphenyl)-2-methyl-4-(4-nitrobenzoyl)-3-thiophen-2-ylpyrrolidine-2-carboxylic acid (PubChem CID 23993867) has the molecular formula C28H26N2O7S and a molecular weight of 534.59 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-5-(4-methoxyphenyl)-2-methyl-4-(4-nitrobenzoyl)-3-thiophen-2-ylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-(cyclopropanecarbonyl)-5-(4-methoxyphenyl)-2-methyl-4-(4-nitrobenzoyl)-3-thiophen-2-ylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23993867 |
| Molecular Formula | C28H26N2O7S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-5-(4-methoxyphenyl)-2-methyl-4-(4-nitrobenzoyl)-3-thiophen-2-ylpyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C2C(C(=O)c3ccc([N+](=O)[O-])cc3)C(c3cccs3)C(C)(C(=O)O)N2C(=O)C2CC2)cc1 |
| InChI | InChI=1S/C28H26N2O7S/c1-28(27(33)34)23(21-4-3-15-38-21)22(25(31)17-7-11-19(12-8-17)30(35)36)24(29(28)26(32)18-5-6-18)16-9-13-20(37-2)14-10-16/h3-4,7-15,18,22-24H,5-6H2,1-2H3,(H,33,34) |
| InChIKey | WQOKMDJJSQCUKA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|