C21H21NO4 — CID 101136006
(4-methoxyphenyl)-[(1S,2R,3S,4R)-3-(4-nitrophenyl)-2-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 101136006) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (4-methoxyphenyl)-[(1S,2R,3S,4R)-3-(4-nitrophenyl)-2-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | (4-methoxyphenyl)-[(1S,2R,3S,4R)-3-(4-nitrophenyl)-2-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 101136006 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (4-methoxyphenyl)-[(1S,2R,3S,4R)-3-(4-nitrophenyl)-2-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | COc1ccc(C(=O)[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H21NO4/c1-26-18-10-6-14(7-11-18)21(23)20-16-3-2-15(12-16)19(20)13-4-8-17(9-5-13)22(24)25/h4-11,15-16,19-20H,2-3,12H2,1H3/t15-,16+,19+,20-/m1/s1 |
| InChIKey | OCLJUBSNLZQOPJ-GIYDNNGJSA-N |
| XLogP | 4.62 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|