C18H13NO6 — CID 132819586
(1R,1aS,7aR)-4-methoxy-1-(4-nitrobenzoyl)-1a,7a-dihydro-1H-cyclopropa[b]chromen-7-one (PubChem CID 132819586) has the molecular formula C18H13NO6 and a molecular weight of 339.30 g/mol. Its IUPAC name is (1R,1aS,7aR)-4-methoxy-1-(4-nitrobenzoyl)-1a,7a-dihydro-1H-cyclopropa[b]chromen-7-one.
| Compound Name | (1R,1aS,7aR)-4-methoxy-1-(4-nitrobenzoyl)-1a,7a-dihydro-1H-cyclopropa[b]chromen-7-one |
|---|---|
| PubChem CID | 132819586 |
| Molecular Formula | C18H13NO6 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | (1R,1aS,7aR)-4-methoxy-1-(4-nitrobenzoyl)-1a,7a-dihydro-1H-cyclopropa[b]chromen-7-one |
| SMILES | COc1ccc2c(c1)O[C@H]1[C@H](C(=O)c3ccc([N+](=O)[O-])cc3)[C@H]1C2=O |
| InChI | InChI=1S/C18H13NO6/c1-24-11-6-7-12-13(8-11)25-18-14(15(18)17(12)21)16(20)9-2-4-10(5-3-9)19(22)23/h2-8,14-15,18H,1H3/t14-,15-,18-/m0/s1 |
| InChIKey | HQGRIHSPWADWMZ-MPGHIAIKSA-N |
| XLogP | 2.68 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|