C22H12N2O12 — CID 98546550
(4R,5S)-4-(4-nitrobenzoyl)-5-[(2S,3S)-3-(4-nitrobenzoyl)-4,5-dioxooxolan-2-yl]oxolane-2,3-dione (PubChem CID 98546550) has the molecular formula C22H12N2O12 and a molecular weight of 496.34 g/mol. Its IUPAC name is (4R,5S)-4-(4-nitrobenzoyl)-5-[(2S,3S)-3-(4-nitrobenzoyl)-4,5-dioxooxolan-2-yl]oxolane-2,3-dione.
| Compound Name | (4R,5S)-4-(4-nitrobenzoyl)-5-[(2S,3S)-3-(4-nitrobenzoyl)-4,5-dioxooxolan-2-yl]oxolane-2,3-dione |
|---|---|
| PubChem CID | 98546550 |
| Molecular Formula | C22H12N2O12 |
| Molecular Weight | 496.34 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | (4R,5S)-4-(4-nitrobenzoyl)-5-[(2S,3S)-3-(4-nitrobenzoyl)-4,5-dioxooxolan-2-yl]oxolane-2,3-dione |
| SMILES | O=C1O[C@H]([C@H]2OC(=O)C(=O)[C@H]2C(=O)c2ccc([N+](=O)[O-])cc2)[C@@H](C(=O)c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C22H12N2O12/c25-15(9-1-5-11(6-2-9)23(31)32)13-17(27)21(29)35-19(13)20-14(18(28)22(30)36-20)16(26)10-3-7-12(8-4-10)24(33)34/h1-8,13-14,19-20H/t13-,14+,19-,20-/m0/s1 |
| InChIKey | IPGYIDVVHAVPDX-ILWKUFEGSA-N |
| XLogP | 0.79 |
| TPSA | 207.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|