About (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone
(4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone (PubChem CID 132961714) has the molecular formula C16H13NO4
and a molecular weight of 283.28 g/mol. Its IUPAC name is (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone.
Molecular Properties
| Compound Name | (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone |
| PubChem CID | 132961714 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone |
| SMILES | Cc1ccc(C(=O)[C@H]2O[C@@H]2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H13NO4/c1-10-2-4-11(5-3-10)14(18)16-15(21-16)12-6-8-13(9-7-12)17(19)20/h2-9,15-16H,1H3/t15-,16-/m1/s1 |
| InChIKey | ZZCITOUQJFLYAN-HZPDHXFCSA-N |
| XLogP | 3.23 |
| TPSA | 72.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone?
The IUPAC name of (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone (CID 132961714) is (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone.
What is the SMILES notation for (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone?
The canonical SMILES for (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone is Cc1ccc(C(=O)[C@H]2O[C@@H]2c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone?
The InChIKey is ZZCITOUQJFLYAN-HZPDHXFCSA-N. The full InChI is InChI=1S/C16H13NO4/c1-10-2-4-11(5-3-10)14(18)16-15(21-16)12-6-8-13(9-7-12)17(19)20/h2-9,15-16H,1H3/t15-,16-/m1/s1.
What are the key properties of (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone?
(4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone has a molecular weight of 283.28 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)-[(2S,3R)-3-(4-nitrophenyl)oxiran-2-yl]methanone is sourced from PubChem (CID 132961714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).