C16H12ClNO4 — CID 139192082
[(2S,3S)-2-chloro-3-(4-nitrophenyl)oxiran-2-yl]-(4-methylphenyl)methanone (PubChem CID 139192082) has the molecular formula C16H12ClNO4 and a molecular weight of 317.73 g/mol. Its IUPAC name is [(2S,3S)-2-chloro-3-(4-nitrophenyl)oxiran-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [(2S,3S)-2-chloro-3-(4-nitrophenyl)oxiran-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 139192082 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [(2S,3S)-2-chloro-3-(4-nitrophenyl)oxiran-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[C@]2(Cl)O[C@H]2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H12ClNO4/c1-10-2-4-11(5-3-10)14(19)16(17)15(22-16)12-6-8-13(9-7-12)18(20)21/h2-9,15H,1H3/t15-,16-/m0/s1 |
| InChIKey | VLYSWJDFJIALQE-HOTGVXAUSA-N |
| XLogP | 3.79 |
| TPSA | 72.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|