About (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane
(NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane (PubChem CID 172951383) has the molecular formula C14H15N2O3P
and a molecular weight of 290.26 g/mol. Its IUPAC name is (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane.
Molecular Properties
| Compound Name | (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane |
| PubChem CID | 172951383 |
| Molecular Formula | C14H15N2O3P |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane |
| SMILES | Cc1ccc(/C(=N/O)c2ccc([N+](=O)[O-])cc2)cc1.P |
| InChI | InChI=1S/C14H12N2O3.H3P/c1-10-2-4-11(5-3-10)14(15-17)12-6-8-13(9-7-12)16(18)19;/h2-9,17H,1H3;1H3/b15-14-; |
| InChIKey | SSFZSHNPNJCCKT-BGWNKZQTSA-N |
| XLogP | 3.19 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane?
The IUPAC name of (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane (CID 172951383) is (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane.
What is the SMILES notation for (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane?
The canonical SMILES for (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane is Cc1ccc(/C(=N/O)c2ccc([N+](=O)[O-])cc2)cc1.P.
What is the InChIKey of (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane?
The InChIKey is SSFZSHNPNJCCKT-BGWNKZQTSA-N. The full InChI is InChI=1S/C14H12N2O3.H3P/c1-10-2-4-11(5-3-10)14(15-17)12-6-8-13(9-7-12)16(18)19;/h2-9,17H,1H3;1H3/b15-14-;.
What are the key properties of (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane?
(NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane has a molecular weight of 290.26 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-[(4-methylphenyl)-(4-nitrophenyl)methylidene]hydroxylamine;phosphane is sourced from PubChem (CID 172951383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).