C21H18N2O2Se — CID 134997351
1,1-bis(4-methylphenyl)-N-(4-nitrophenyl)selanylmethanimine (PubChem CID 134997351) has the molecular formula C21H18N2O2Se and a molecular weight of 409.35 g/mol. Its IUPAC name is 1,1-bis(4-methylphenyl)-N-(4-nitrophenyl)selanylmethanimine.
| Compound Name | 1,1-bis(4-methylphenyl)-N-(4-nitrophenyl)selanylmethanimine |
|---|---|
| PubChem CID | 134997351 |
| Molecular Formula | C21H18N2O2Se |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 1,1-bis(4-methylphenyl)-N-(4-nitrophenyl)selanylmethanimine |
| SMILES | Cc1ccc(C(=N[Se]c2ccc([N+](=O)[O-])cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H18N2O2Se/c1-15-3-7-17(8-4-15)21(18-9-5-16(2)6-10-18)22-26-20-13-11-19(12-14-20)23(24)25/h3-14H,1-2H3 |
| InChIKey | QDGSIKZYBKKAAE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|