C23H21N3O4 — CID 166063764
N-(4-tert-butylphenyl)-1,1-bis(4-nitrophenyl)methanimine (PubChem CID 166063764) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1,1-bis(4-nitrophenyl)methanimine.
| Compound Name | N-(4-tert-butylphenyl)-1,1-bis(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 166063764 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-1,1-bis(4-nitrophenyl)methanimine |
| SMILES | CC(C)(C)c1ccc(N=C(c2ccc([N+](=O)[O-])cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-23(2,3)18-8-10-19(11-9-18)24-22(16-4-12-20(13-5-16)25(27)28)17-6-14-21(15-7-17)26(29)30/h4-15H,1-3H3 |
| InChIKey | AAZSAWCANVPKFJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|