C13H19N3O2 — CID 525893
N,N,2,2-tetramethyl-N'-(4-nitrophenyl)propanimidamide (PubChem CID 525893) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-N'-(4-nitrophenyl)propanimidamide.
| Compound Name | N,N,2,2-tetramethyl-N'-(4-nitrophenyl)propanimidamide |
|---|---|
| PubChem CID | 525893 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N,N,2,2-tetramethyl-N'-(4-nitrophenyl)propanimidamide |
| SMILES | CN(C)/C(=N\c1ccc([N+](=O)[O-])cc1)C(C)(C)C |
| InChI | InChI=1S/C13H19N3O2/c1-13(2,3)12(15(4)5)14-10-6-8-11(9-7-10)16(17)18/h6-9H,1-5H3/b14-12- |
| InChIKey | WHUWWSOADACHNY-OWBHPGMISA-N |
| XLogP | 3.23 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|