About mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate
mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate (PubChem CID 10437179) has the molecular formula C13H9HgN3O4S2
and a molecular weight of 535.96 g/mol. Its IUPAC name is mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate.
Molecular Properties
| Compound Name | mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate |
| PubChem CID | 10437179 |
| Molecular Formula | C13H9HgN3O4S2 |
| Molecular Weight | 535.96 g/mol |
| Exact Mass | 536.97 |
| IUPAC Name | mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate |
| SMILES | O=[N+]([O-])c1ccc(N=C([S-])[S-])cc1.O=[N+]([O-])c1ccccc1.[Hg+2] |
| InChI | InChI=1S/C7H6N2O2S2.C6H5NO2.Hg/c10-9(11)6-3-1-5(2-4-6)8-7(12)13;8-7(9)6-4-2-1-3-5-6;/h1-4H,(H2,8,12,13);1-5H;/q;;+2/p-2 |
| InChIKey | KBEKWFLHGIWYES-UHFFFAOYSA-L |
| XLogP | 3.27 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 535.96 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate?
The IUPAC name of mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate (CID 10437179) is mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate.
What is the SMILES notation for mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate?
The canonical SMILES for mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate is O=[N+]([O-])c1ccc(N=C([S-])[S-])cc1.O=[N+]([O-])c1ccccc1.[Hg+2].
What is the InChIKey of mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate?
The InChIKey is KBEKWFLHGIWYES-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6N2O2S2.C6H5NO2.Hg/c10-9(11)6-3-1-5(2-4-6)8-7(12)13;8-7(9)6-4-2-1-3-5-6;/h1-4H,(H2,8,12,13);1-5H;/q;;+2/p-2.
What are the key properties of mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate?
mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate has a molecular weight of 535.96 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(2+);nitrobenzene;(4-nitrophenyl)iminomethanedithiolate is sourced from PubChem (CID 10437179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).